Urolithin B (1139-83-9 factory Továrna výrobce

Urolithin B.

Listopadu 9, 2020

Urolithin BSPECIFIKACE

Jméno: Urolithin B.
Chemický název: 3-Hydroxy-6H-dibenzo [b, d] pyran-6-on
CAS: 1139 83--9
Chemický vzorec: C13H8O3
Molekulární váha: X
Barva:  Bílý prášek
Klíč InChi: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kód: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkce: Urolithin B může zlepšit mitochondriální a svalovou funkci.

Urolithin B může zlepšit sílu svalů a vytrvalost během stárnutí.

Použití: Urolithin B je střevní mikrobiální metabolit ellagitannis a vykazuje silné antioxidační a prooxidační aktivity v závislosti na systému a podmínkách testu. Urolithin B může také vykazovat estrogenní a / nebo antiestrogenní aktivitu.
Rozpustnost: Snadno rozpustný v N, N-dimethylformamidu a dimethylmethylenu. Sulfon, mírně rozpustný v methanolu, ethanolu a ethylacetátu
Teplota ukládání: Hygroskopický, -20 ° C mrazák, Pod inertní atmosférou
Stav dopravy: Dodává se při teplotě okolí jako chemická látka, která není nebezpečná. Tento produkt je dostatečně stabilní po dobu několika týdnů během běžné přepravy a času stráveného v celním úřadě.